C30H36ClN3O4 — CID 166706507
tert-butyl (3S,4Z)-4-[3-[4-[[3-(4-chlorophenyl)-2-iminopropanoyl]amino]phenyl]-2-oxopropylidene]-3-methylazepane-1-carboxylate (PubChem CID 166706507) has the molecular formula C30H36ClN3O4 and a molecular weight of 538.09 g/mol. Its IUPAC name is tert-butyl (3S,4Z)-4-[3-[4-[[3-(4-chlorophenyl)-2-iminopropanoyl]amino]phenyl]-2-oxopropylidene]-3-methylazepane-1-carboxylate.
| Compound Name | tert-butyl (3S,4Z)-4-[3-[4-[[3-(4-chlorophenyl)-2-iminopropanoyl]amino]phenyl]-2-oxopropylidene]-3-methylazepane-1-carboxylate |
|---|---|
| PubChem CID | 166706507 |
| Molecular Formula | C30H36ClN3O4 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | tert-butyl (3S,4Z)-4-[3-[4-[[3-(4-chlorophenyl)-2-iminopropanoyl]amino]phenyl]-2-oxopropylidene]-3-methylazepane-1-carboxylate |
| SMILES | [H]/N=C(/Cc1ccc(Cl)cc1)C(=O)Nc1ccc(CC(=O)/C=C2/CCCN(C(=O)OC(C)(C)C)C[C@H]2C)cc1 |
| InChI | InChI=1S/C30H36ClN3O4/c1-20-19-34(29(37)38-30(2,3)4)15-5-6-23(20)18-26(35)16-21-9-13-25(14-10-21)33-28(36)27(32)17-22-7-11-24(31)12-8-22/h7-14,18,20,32H,5-6,15-17,19H2,1-4H3,(H,33,36)/b23-18-,32-27-/t20-/m1/s1 |
| InChIKey | YRGWIWMVJXGQHB-OQDYYVSDSA-N |
| XLogP | 6.25 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|