About tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride
tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride (PubChem CID 133063383) has the molecular formula C12H22ClNO3
and a molecular weight of 263.76 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride |
| PubChem CID | 133063383 |
| Molecular Formula | C12H22ClNO3 |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCCC1=O.Cl |
| InChI | InChI=1S/C12H21NO3.ClH/c1-9-8-13(7-5-6-10(9)14)11(15)16-12(2,3)4;/h9H,5-8H2,1-4H3;1H |
| InChIKey | UBCHFONXEUNOGW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride?
The IUPAC name of tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride (CID 133063383) is tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride.
What is the SMILES notation for tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride?
The canonical SMILES for tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride is CC1CN(C(=O)OC(C)(C)C)CCCC1=O.Cl.
What is the InChIKey of tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride?
The InChIKey is UBCHFONXEUNOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3.ClH/c1-9-8-13(7-5-6-10(9)14)11(15)16-12(2,3)4;/h9H,5-8H2,1-4H3;1H.
What are the key properties of tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride?
tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride has a molecular weight of 263.76 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methyl-4-oxoazepane-1-carboxylate;hydrochloride is sourced from PubChem (CID 133063383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).