C11H20N2O3 — CID 75355418
tert-butyl 3-amino-4-oxoazepane-1-carboxylate (PubChem CID 75355418) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl 3-amino-4-oxoazepane-1-carboxylate.
| Compound Name | tert-butyl 3-amino-4-oxoazepane-1-carboxylate |
|---|---|
| PubChem CID | 75355418 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl 3-amino-4-oxoazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=O)C(N)C1 |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,3)16-10(15)13-6-4-5-9(14)8(12)7-13/h8H,4-7,12H2,1-3H3 |
| InChIKey | BFNKBFQHRKFBNU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |