C31H33F2N5O4S — CID 88857961
(Z)-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]-3-[4-[(4-pyridin-4-ylphenyl)methylsulfonyl]piperazin-1-yl]but-2-enamide (PubChem CID 88857961) has the molecular formula C31H33F2N5O4S and a molecular weight of 609.70 g/mol. Its IUPAC name is (Z)-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]-3-[4-[(4-pyridin-4-ylphenyl)methylsulfonyl]piperazin-1-yl]but-2-enamide.
| Compound Name | (Z)-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]-3-[4-[(4-pyridin-4-ylphenyl)methylsulfonyl]piperazin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 88857961 |
| Molecular Formula | C31H33F2N5O4S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | (Z)-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]-3-[4-[(4-pyridin-4-ylphenyl)methylsulfonyl]piperazin-1-yl]but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCC1(C)CC1)C(=O)Nc1cc(F)cc(F)c1)N1CCN(S(=O)(=O)Cc2ccc(-c3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C31H33F2N5O4S/c1-31(8-9-31)21-42-29(30(39)36-27-17-25(32)16-26(33)18-27)28(19-34)37-12-14-38(15-13-37)43(40,41)20-22-2-4-23(5-3-22)24-6-10-35-11-7-24/h2-7,10-11,16-19,34H,8-9,12-15,20-21H2,1H3,(H,36,39)/b29-28-,34-19+ |
| InChIKey | ZYWWSRVKXCWJJR-MMTMWLRQSA-N |
| XLogP | 4.79 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|