C26H32F2N5O2S+ — CID 145478798
(Z)-3-[4-[(4-aminophenyl)methylsulfanyl]piperazin-4-ium-1-yl]-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]but-2-enamide (PubChem CID 145478798) has the molecular formula C26H32F2N5O2S+ and a molecular weight of 516.64 g/mol. Its IUPAC name is (Z)-3-[4-[(4-aminophenyl)methylsulfanyl]piperazin-4-ium-1-yl]-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]but-2-enamide.
| Compound Name | (Z)-3-[4-[(4-aminophenyl)methylsulfanyl]piperazin-4-ium-1-yl]-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]but-2-enamide |
|---|---|
| PubChem CID | 145478798 |
| Molecular Formula | C26H32F2N5O2S+ |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | (Z)-3-[4-[(4-aminophenyl)methylsulfanyl]piperazin-4-ium-1-yl]-N-(3,5-difluorophenyl)-4-imino-2-[(1-methylcyclopropyl)methoxy]but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCC1(C)CC1)C(=O)Nc1cc(F)cc(F)c1)N1CC[NH+](SCc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C26H31F2N5O2S/c1-26(6-7-26)17-35-24(25(34)31-22-13-19(27)12-20(28)14-22)23(15-29)32-8-10-33(11-9-32)36-16-18-2-4-21(30)5-3-18/h2-5,12-15,29H,6-11,16-17,30H2,1H3,(H,31,34)/p+1/b24-23-,29-15+ |
| InChIKey | BUAGJVNLJVFVQX-JZLOBLLDSA-O |
| XLogP | 3.21 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|