C28H33ClN6O4S2 — CID 70686165
(Z)-N-(3-chlorophenyl)-4-imino-3-[4-[(2-methyl-1,3-benzothiazol-6-yl)methylsulfamoyl]piperazin-1-yl]-2-[(1-methylcyclopropyl)methoxy]but-2-enamide (PubChem CID 70686165) has the molecular formula C28H33ClN6O4S2 and a molecular weight of 617.20 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-4-imino-3-[4-[(2-methyl-1,3-benzothiazol-6-yl)methylsulfamoyl]piperazin-1-yl]-2-[(1-methylcyclopropyl)methoxy]but-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-4-imino-3-[4-[(2-methyl-1,3-benzothiazol-6-yl)methylsulfamoyl]piperazin-1-yl]-2-[(1-methylcyclopropyl)methoxy]but-2-enamide |
|---|---|
| PubChem CID | 70686165 |
| Molecular Formula | C28H33ClN6O4S2 |
| Molecular Weight | 617.20 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-4-imino-3-[4-[(2-methyl-1,3-benzothiazol-6-yl)methylsulfamoyl]piperazin-1-yl]-2-[(1-methylcyclopropyl)methoxy]but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCC1(C)CC1)C(=O)Nc1cccc(Cl)c1)N1CCN(S(=O)(=O)NCc2ccc3nc(C)sc3c2)CC1 |
| InChI | InChI=1S/C28H33ClN6O4S2/c1-19-32-23-7-6-20(14-25(23)40-19)17-31-41(37,38)35-12-10-34(11-13-35)24(16-30)26(39-18-28(2)8-9-28)27(36)33-22-5-3-4-21(29)15-22/h3-7,14-16,30-31H,8-13,17-18H2,1-2H3,(H,33,36)/b26-24-,30-16+ |
| InChIKey | CLISBDIPJYYXQR-IXWVJBSQSA-N |
| XLogP | 4.53 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|