C29H36F2N4O4 — CID 88857952
(Z)-N-(3,5-difluorophenyl)-4-imino-2-[[1-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]methoxy]-3-(4-methylpiperazin-1-yl)but-2-enamide (PubChem CID 88857952) has the molecular formula C29H36F2N4O4 and a molecular weight of 542.63 g/mol. Its IUPAC name is (Z)-N-(3,5-difluorophenyl)-4-imino-2-[[1-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]methoxy]-3-(4-methylpiperazin-1-yl)but-2-enamide.
| Compound Name | (Z)-N-(3,5-difluorophenyl)-4-imino-2-[[1-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]methoxy]-3-(4-methylpiperazin-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 88857952 |
| Molecular Formula | C29H36F2N4O4 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | (Z)-N-(3,5-difluorophenyl)-4-imino-2-[[1-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclopropyl]methoxy]-3-(4-methylpiperazin-1-yl)but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCC1(CCOCc2ccc(OC)cc2)CC1)C(=O)Nc1cc(F)cc(F)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C29H36F2N4O4/c1-34-10-12-35(13-11-34)26(18-32)27(28(36)33-24-16-22(30)15-23(31)17-24)39-20-29(7-8-29)9-14-38-19-21-3-5-25(37-2)6-4-21/h3-6,15-18,32H,7-14,19-20H2,1-2H3,(H,33,36)/b27-26-,32-18+ |
| InChIKey | MXFAIVJBUICAPW-HSVXZTSWSA-N |
| XLogP | 4.42 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|