C25H30FN4O3S+ — CID 163724840
[3-[(Z)-3-[(3-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-4-(3-hydroxyanilino)-1-imino-4-oxobut-2-en-2-yl]-1,3-diazetidin-1-yl]-propan-2-ylsulfanium (PubChem CID 163724840) has the molecular formula C25H30FN4O3S+ and a molecular weight of 485.61 g/mol. Its IUPAC name is [3-[(Z)-3-[(3-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-4-(3-hydroxyanilino)-1-imino-4-oxobut-2-en-2-yl]-1,3-diazetidin-1-yl]-propan-2-ylsulfanium.
| Compound Name | [3-[(Z)-3-[(3-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-4-(3-hydroxyanilino)-1-imino-4-oxobut-2-en-2-yl]-1,3-diazetidin-1-yl]-propan-2-ylsulfanium |
|---|---|
| PubChem CID | 163724840 |
| Molecular Formula | C25H30FN4O3S+ |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [3-[(Z)-3-[(3-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-4-(3-hydroxyanilino)-1-imino-4-oxobut-2-en-2-yl]-1,3-diazetidin-1-yl]-propan-2-ylsulfanium |
| SMILES | [H]/N=C/C(=C(/OC1Cc2ccccc2CC1F)C(=O)Nc1cccc(O)c1)N1CN([SH+]C(C)C)C1 |
| InChI | InChI=1S/C25H29FN4O3S/c1-16(2)34-30-14-29(15-30)22(13-27)24(25(32)28-19-8-5-9-20(31)12-19)33-23-11-18-7-4-3-6-17(18)10-21(23)26/h3-9,12-13,16,21,23,27,31H,10-11,14-15H2,1-2H3,(H,28,32)/p+1/b24-22-,27-13+ |
| InChIKey | KURFZIXFGPNSET-GZJWQIQKSA-O |
| XLogP | 3.38 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|