C32H34ClN3O2 — CID 145479755
(2Z)-2-amino-2-[(3E)-2-(2-chloro-4-methylphenyl)imino-3-[(4-methoxyphenyl)methylidene]cycloheptylidene]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 145479755) has the molecular formula C32H34ClN3O2 and a molecular weight of 528.10 g/mol. Its IUPAC name is (2Z)-2-amino-2-[(3E)-2-(2-chloro-4-methylphenyl)imino-3-[(4-methoxyphenyl)methylidene]cycloheptylidene]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | (2Z)-2-amino-2-[(3E)-2-(2-chloro-4-methylphenyl)imino-3-[(4-methoxyphenyl)methylidene]cycloheptylidene]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 145479755 |
| Molecular Formula | C32H34ClN3O2 |
| Molecular Weight | 528.10 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (2Z)-2-amino-2-[(3E)-2-(2-chloro-4-methylphenyl)imino-3-[(4-methoxyphenyl)methylidene]cycloheptylidene]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | COc1ccc(/C=C2\CCCCC(=C(/N)C(=O)N[C@H](C)c3ccccc3)/C2=N/c2ccc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C32H34ClN3O2/c1-21-13-18-29(28(33)19-21)36-31-25(20-23-14-16-26(38-3)17-15-23)11-7-8-12-27(31)30(34)32(37)35-22(2)24-9-5-4-6-10-24/h4-6,9-10,13-20,22H,7-8,11-12,34H2,1-3H3,(H,35,37)/b25-20+,30-27-,36-31+/t22-/m1/s1 |
| InChIKey | MVIRAFFAINTMCO-DADREKTRSA-N |
| XLogP | 7.48 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.10 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|