C25H28ClN3OS — CID 145479845
(E,3Z)-3-amino-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-iminocycloheptylidene]-N-[(1S)-1-phenylethyl]prop-1-ene-1-sulfinamide (PubChem CID 145479845) has the molecular formula C25H28ClN3OS and a molecular weight of 454.04 g/mol. Its IUPAC name is (E,3Z)-3-amino-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-iminocycloheptylidene]-N-[(1S)-1-phenylethyl]prop-1-ene-1-sulfinamide.
| Compound Name | (E,3Z)-3-amino-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-iminocycloheptylidene]-N-[(1S)-1-phenylethyl]prop-1-ene-1-sulfinamide |
|---|---|
| PubChem CID | 145479845 |
| Molecular Formula | C25H28ClN3OS |
| Molecular Weight | 454.04 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (E,3Z)-3-amino-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-iminocycloheptylidene]-N-[(1S)-1-phenylethyl]prop-1-ene-1-sulfinamide |
| SMILES | [H]/N=C1\C(=C\c2ccc(Cl)cc2)\CCCC\C1=C(N)\C=C\S(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H28ClN3OS/c1-18(20-7-3-2-4-8-20)29-31(30)16-15-24(27)23-10-6-5-9-21(25(23)28)17-19-11-13-22(26)14-12-19/h2-4,7-8,11-18,28-29H,5-6,9-10,27H2,1H3/b16-15+,21-17+,24-23-,28-25+/t18-,31?/m0/s1 |
| InChIKey | FXZPLLSHPWITEF-WPGITASZSA-N |
| XLogP | 6.06 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|