C10H14ClN5O — CID 145480225
2-chloro-5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 145480225) has the molecular formula C10H14ClN5O and a molecular weight of 255.71 g/mol. Its IUPAC name is 2-chloro-5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 2-chloro-5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 145480225 |
| Molecular Formula | C10H14ClN5O |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-chloro-5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | [H]/N=C(\C)c1c(N)nc(Cl)nc1N1CCOCC1 |
| InChI | InChI=1S/C10H14ClN5O/c1-6(12)7-8(13)14-10(11)15-9(7)16-2-4-17-5-3-16/h12H,2-5H2,1H3,(H2,13,14,15)/b12-6+ |
| InChIKey | IKXXDZKXTZREDC-WUXMJOGZSA-N |
| XLogP | 0.94 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|