C23H29FN5O3S+ — CID 145480384
[4-[3-cyclohexyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-3-oxopiperazin-1-yl]-[(4-fluorophenyl)methyl]-oxoazanium (PubChem CID 145480384) has the molecular formula C23H29FN5O3S+ and a molecular weight of 474.58 g/mol. Its IUPAC name is [4-[3-cyclohexyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-3-oxopiperazin-1-yl]-[(4-fluorophenyl)methyl]-oxoazanium.
| Compound Name | [4-[3-cyclohexyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-3-oxopiperazin-1-yl]-[(4-fluorophenyl)methyl]-oxoazanium |
|---|---|
| PubChem CID | 145480384 |
| Molecular Formula | C23H29FN5O3S+ |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [4-[3-cyclohexyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-3-oxopiperazin-1-yl]-[(4-fluorophenyl)methyl]-oxoazanium |
| SMILES | O=C(Nc1nccs1)C(CC1CCCCC1)N1CCN([N+](=O)Cc2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C23H28FN5O3S/c24-19-8-6-18(7-9-19)15-29(32)27-11-12-28(21(30)16-27)20(14-17-4-2-1-3-5-17)22(31)26-23-25-10-13-33-23/h6-10,13,17,20H,1-5,11-12,14-16H2/p+1 |
| InChIKey | SRNNVJWPHWWXIZ-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|