C21H25N3O2S — CID 10271316
3-cycloheptyl-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 10271316) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 3-cycloheptyl-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-cycloheptyl-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 10271316 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-cycloheptyl-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(CC1CCCCCC1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C21H25N3O2S/c25-19(23-21-22-11-12-27-21)18(13-15-7-3-1-2-4-8-15)24-14-16-9-5-6-10-17(16)20(24)26/h5-6,9-12,15,18H,1-4,7-8,13-14H2,(H,22,23,25) |
| InChIKey | CRJFRTOZGDAQPG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |