C24H26ClN3O3 — CID 1480143
4-chloro-N'-[(2R)-3-cyclohexyl-2-(3-oxo-1H-isoindol-2-yl)propanoyl]benzohydrazide (PubChem CID 1480143) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is 4-chloro-N'-[(2R)-3-cyclohexyl-2-(3-oxo-1H-isoindol-2-yl)propanoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[(2R)-3-cyclohexyl-2-(3-oxo-1H-isoindol-2-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 1480143 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-chloro-N'-[(2R)-3-cyclohexyl-2-(3-oxo-1H-isoindol-2-yl)propanoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)[C@@H](CC1CCCCC1)N1Cc2ccccc2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClN3O3/c25-19-12-10-17(11-13-19)22(29)26-27-23(30)21(14-16-6-2-1-3-7-16)28-15-18-8-4-5-9-20(18)24(28)31/h4-5,8-13,16,21H,1-3,6-7,14-15H2,(H,26,29)(H,27,30)/t21-/m1/s1 |
| InChIKey | TWMIBIALAUCFRL-OAQYLSRUSA-N |
| XLogP | 4.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|