C20H21ClN4O4S — CID 18402205
N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(5-nitro-3-oxo-1H-isoindol-2-yl)propanamide (PubChem CID 18402205) has the molecular formula C20H21ClN4O4S and a molecular weight of 448.93 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(5-nitro-3-oxo-1H-isoindol-2-yl)propanamide.
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(5-nitro-3-oxo-1H-isoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 18402205 |
| Molecular Formula | C20H21ClN4O4S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(5-nitro-3-oxo-1H-isoindol-2-yl)propanamide |
| SMILES | O=C(Nc1ncc(Cl)s1)C(CC1CCCCC1)N1Cc2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C20H21ClN4O4S/c21-17-10-22-20(30-17)23-18(26)16(8-12-4-2-1-3-5-12)24-11-13-6-7-14(25(28)29)9-15(13)19(24)27/h6-7,9-10,12,16H,1-5,8,11H2,(H,22,23,26) |
| InChIKey | SZDIMEPRHLQIJE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|