C20H21ClN4O4S — CID 91321239
(2S)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(1-hydroxy-5-nitroisoindol-2-yl)propanamide (PubChem CID 91321239) has the molecular formula C20H21ClN4O4S and a molecular weight of 448.93 g/mol. Its IUPAC name is (2S)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(1-hydroxy-5-nitroisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(1-hydroxy-5-nitroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 91321239 |
| Molecular Formula | C20H21ClN4O4S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (2S)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclohexyl-2-(1-hydroxy-5-nitroisoindol-2-yl)propanamide |
| SMILES | O=C(Nc1ncc(Cl)s1)[C@H](CC1CCCCC1)n1cc2cc([N+](=O)[O-])ccc2c1O |
| InChI | InChI=1S/C20H21ClN4O4S/c21-17-10-22-20(30-17)23-18(26)16(8-12-4-2-1-3-5-12)24-11-13-9-14(25(28)29)6-7-15(13)19(24)27/h6-7,9-12,16,27H,1-5,8H2,(H,22,23,26)/t16-/m0/s1 |
| InChIKey | LHUIOKMPIVUXEQ-INIZCTEOSA-N |
| XLogP | 5.52 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|