C27H25NO5 — CID 145481415
6-(3-hydroxyphenyl)-1-[4-(methylamino)phenyl]naphthalen-2-ol;4-oxobutanoic acid (PubChem CID 145481415) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 6-(3-hydroxyphenyl)-1-[4-(methylamino)phenyl]naphthalen-2-ol;4-oxobutanoic acid.
| Compound Name | 6-(3-hydroxyphenyl)-1-[4-(methylamino)phenyl]naphthalen-2-ol;4-oxobutanoic acid |
|---|---|
| PubChem CID | 145481415 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 6-(3-hydroxyphenyl)-1-[4-(methylamino)phenyl]naphthalen-2-ol;4-oxobutanoic acid |
| SMILES | CNc1ccc(-c2c(O)ccc3cc(-c4cccc(O)c4)ccc23)cc1.O=CCCC(=O)O |
| InChI | InChI=1S/C23H19NO2.C4H6O3/c1-24-19-9-5-15(6-10-19)23-21-11-7-17(13-18(21)8-12-22(23)26)16-3-2-4-20(25)14-16;5-3-1-2-4(6)7/h2-14,24-26H,1H3;3H,1-2H2,(H,6,7) |
| InChIKey | WQXYZUZDLKGAPU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|