C23H47N3S — CID 145481649
(5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide;ethane;1-ethylsulfanylpropane (PubChem CID 145481649) has the molecular formula C23H47N3S and a molecular weight of 397.72 g/mol. Its IUPAC name is (5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide;ethane;1-ethylsulfanylpropane.
| Compound Name | (5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide;ethane;1-ethylsulfanylpropane |
|---|---|
| PubChem CID | 145481649 |
| Molecular Formula | C23H47N3S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 397.35 |
| IUPAC Name | (5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide;ethane;1-ethylsulfanylpropane |
| SMILES | C=C(C)NC(=N\CCCC)/C1=C(\C)CCCNCC1.CC.CCCSCC |
| InChI | InChI=1S/C16H29N3.C5H12S.C2H6/c1-5-6-11-18-16(19-13(2)3)15-9-12-17-10-7-8-14(15)4;1-3-5-6-4-2;1-2/h17H,2,5-12H2,1,3-4H3,(H,18,19);3-5H2,1-2H3;1-2H3/b15-14+;; |
| InChIKey | KPDXRKOVBGUYKX-NSKUCRDLSA-N |
| XLogP | 6.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|