C16H29N3 — CID 145481650
(5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide (PubChem CID 145481650) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is (5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide.
| Compound Name | (5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide |
|---|---|
| PubChem CID | 145481650 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | (5E)-N'-butyl-5-methyl-N-prop-1-en-2-yl-1,2,3,4,7,8-hexahydroazocine-6-carboximidamide |
| SMILES | C=C(C)NC(=N\CCCC)/C1=C(\C)CCCNCC1 |
| InChI | InChI=1S/C16H29N3/c1-5-6-11-18-16(19-13(2)3)15-9-12-17-10-7-8-14(15)4/h17H,2,5-12H2,1,3-4H3,(H,18,19)/b15-14+ |
| InChIKey | AAHILVMFLCYQCE-CCEZHUSRSA-N |
| XLogP | 3.40 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|