C12H19N3 — CID 163898136
2-amino-N'-cyclopropyl-N-prop-1-en-2-ylcyclopentene-1-carboximidamide (PubChem CID 163898136) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-amino-N'-cyclopropyl-N-prop-1-en-2-ylcyclopentene-1-carboximidamide.
| Compound Name | 2-amino-N'-cyclopropyl-N-prop-1-en-2-ylcyclopentene-1-carboximidamide |
|---|---|
| PubChem CID | 163898136 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-amino-N'-cyclopropyl-N-prop-1-en-2-ylcyclopentene-1-carboximidamide |
| SMILES | C=C(C)N/C(=N\C1CC1)C1=C(N)CCC1 |
| InChI | InChI=1S/C12H19N3/c1-8(2)14-12(15-9-6-7-9)10-4-3-5-11(10)13/h9H,1,3-7,13H2,2H3,(H,14,15) |
| InChIKey | QHLVYKHFGBOQRR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|