About (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide
(Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide (PubChem CID 144528709) has the molecular formula C14H25BrN4
and a molecular weight of 329.29 g/mol. Its IUPAC name is (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide.
Molecular Properties
| Compound Name | (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide |
| PubChem CID | 144528709 |
| Molecular Formula | C14H25BrN4 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide |
| SMILES | C=C(CC)C/C(N)=C(C(/Br)=N/C)\C(=N\C)NC(C)C |
| InChI | InChI=1S/C14H25BrN4/c1-7-10(4)8-11(16)12(13(15)17-5)14(18-6)19-9(2)3/h9H,4,7-8,16H2,1-3,5-6H3,(H,18,19)/b12-11+,17-13- |
| InChIKey | SLHYNTMZFZCWGM-VBEVGYOXSA-N |
| XLogP | 3.01 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide?
The IUPAC name of (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide (CID 144528709) is (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide.
What is the SMILES notation for (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide?
The canonical SMILES for (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide is C=C(CC)C/C(N)=C(C(/Br)=N/C)\C(=N\C)NC(C)C.
What is the InChIKey of (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide?
The InChIKey is SLHYNTMZFZCWGM-VBEVGYOXSA-N. The full InChI is InChI=1S/C14H25BrN4/c1-7-10(4)8-11(16)12(13(15)17-5)14(18-6)19-9(2)3/h9H,4,7-8,16H2,1-3,5-6H3,(H,18,19)/b12-11+,17-13-.
What are the key properties of (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide?
(Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide has a molecular weight of 329.29 g/mol, XLogP of 3.01, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N-methyl-5-methylidene-2-(N'-methyl-N-propan-2-ylcarbamimidoyl)hept-2-enimidoyl bromide is sourced from PubChem (CID 144528709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).