C20H23F3N4O — CID 145481749
3-[[1-cyclohexyl-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol (PubChem CID 145481749) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[[1-cyclohexyl-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[1-cyclohexyl-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 145481749 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[[1-cyclohexyl-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc2cc(C(F)(F)F)ccc2c2c1ncn2C1CCCCC1 |
| InChI | InChI=1S/C20H23F3N4O/c21-20(22,23)13-7-8-15-16(11-13)26-19(24-9-4-10-28)17-18(15)27(12-25-17)14-5-2-1-3-6-14/h7-8,11-12,14,28H,1-6,9-10H2,(H,24,26) |
| InChIKey | ZRRSHGPCACBXLY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|