C18H31NO5 — CID 145482364
but-1-ene;methyl (3S,6S,7S,7aS)-3-butyl-7-hydroxy-6,7-dimethyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 145482364) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is but-1-ene;methyl (3S,6S,7S,7aS)-3-butyl-7-hydroxy-6,7-dimethyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | but-1-ene;methyl (3S,6S,7S,7aS)-3-butyl-7-hydroxy-6,7-dimethyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 145482364 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | but-1-ene;methyl (3S,6S,7S,7aS)-3-butyl-7-hydroxy-6,7-dimethyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | C=CCC.CCCC[C@@H]1OC[C@]2(C(=O)OC)N1C(=O)[C@@H](C)[C@]2(C)O |
| InChI | InChI=1S/C14H23NO5.C4H8/c1-5-6-7-10-15-11(16)9(2)13(3,18)14(15,8-20-10)12(17)19-4;1-3-4-2/h9-10,18H,5-8H2,1-4H3;3H,1,4H2,2H3/t9-,10+,13+,14-;/m1./s1 |
| InChIKey | LSSQUQBEEGWTII-PHTNOOMGSA-N |
| XLogP | 2.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|