C28H32ClN3O8 — CID 14548271
5-O-[2-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 14548271) has the molecular formula C28H32ClN3O8 and a molecular weight of 574.03 g/mol. Its IUPAC name is 5-O-[2-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | 5-O-[2-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 14548271 |
| Molecular Formula | C28H32ClN3O8 |
| Molecular Weight | 574.03 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 5-O-[2-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)CC2COc3ccccc3O2)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C28H31N3O8.ClH/c1-17-24(27(32)36-4)26(19-8-7-9-20(14-19)31(34)35)25(18(2)29-17)28(33)37-13-12-30(3)15-21-16-38-22-10-5-6-11-23(22)39-21;/h5-11,14,21,26,29H,12-13,15-16H2,1-4H3;1H |
| InChIKey | JBVYGYAMSQNLSU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.03 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|