C14H12F2O3 — CID 145483190
(3E)-1-[4-(difluoromethoxy)phenyl]-3-methylhexa-3,5-diene-1,2-dione (PubChem CID 145483190) has the molecular formula C14H12F2O3 and a molecular weight of 266.24 g/mol. Its IUPAC name is (3E)-1-[4-(difluoromethoxy)phenyl]-3-methylhexa-3,5-diene-1,2-dione.
| Compound Name | (3E)-1-[4-(difluoromethoxy)phenyl]-3-methylhexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 145483190 |
| Molecular Formula | C14H12F2O3 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (3E)-1-[4-(difluoromethoxy)phenyl]-3-methylhexa-3,5-diene-1,2-dione |
| SMILES | C=C/C=C(\C)C(=O)C(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H12F2O3/c1-3-4-9(2)12(17)13(18)10-5-7-11(8-6-10)19-14(15)16/h3-8,14H,1H2,2H3/b9-4+ |
| InChIKey | CFEXWGHFMNJFIZ-RUDMXATFSA-N |
| XLogP | 3.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|