C21H12ClN3O2S — CID 145483309
2-[[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 145483309) has the molecular formula C21H12ClN3O2S and a molecular weight of 405.87 g/mol. Its IUPAC name is 2-[[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 145483309 |
| Molecular Formula | C21H12ClN3O2S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-[[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc2cccc(Cl)c2nc1-c1cncs1 |
| InChI | InChI=1S/C21H12ClN3O2S/c22-16-7-3-4-12-8-13(19(24-18(12)16)17-9-23-11-28-17)10-25-20(26)14-5-1-2-6-15(14)21(25)27/h1-9,11H,10H2 |
| InChIKey | AXOOFJJMCWQAOS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|