C24H15ClFN3O2 — CID 76599357
2-[1-[8-chloro-2-(5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 76599357) has the molecular formula C24H15ClFN3O2 and a molecular weight of 431.85 g/mol. Its IUPAC name is 2-[1-[8-chloro-2-(5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[8-chloro-2-(5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 76599357 |
| Molecular Formula | C24H15ClFN3O2 |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-[1-[8-chloro-2-(5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1cc2cccc(Cl)c2nc1-c1cncc(F)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H15ClFN3O2/c1-13(29-23(30)17-6-2-3-7-18(17)24(29)31)19-10-14-5-4-8-20(25)22(14)28-21(19)15-9-16(26)12-27-11-15/h2-13H,1H3 |
| InChIKey | MFNRIMNHOWURPO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|