C16H19NO5 — CID 145484381
2-[[2-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-nitrophenoxy]methyl]oxirane (PubChem CID 145484381) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[[2-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-nitrophenoxy]methyl]oxirane.
| Compound Name | 2-[[2-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-nitrophenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 145484381 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[[2-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-nitrophenoxy]methyl]oxirane |
| SMILES | C/C=C\C(=C/C)COc1cc([N+](=O)[O-])ccc1OCC1CO1 |
| InChI | InChI=1S/C16H19NO5/c1-3-5-12(4-2)9-21-16-8-13(17(18)19)6-7-15(16)22-11-14-10-20-14/h3-8,14H,9-11H2,1-2H3/b5-3-,12-4+ |
| InChIKey | ARWUNJBYTLISTI-BVEFSZSYSA-N |
| XLogP | 3.27 |
| TPSA | 74.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|