C24H30N4O3S2 — CID 145485784
2-[2-[[2-[(2-octylanilino)methyl]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 145485784) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-[2-[[2-[(2-octylanilino)methyl]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[2-[(2-octylanilino)methyl]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 145485784 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[2-[[2-[(2-octylanilino)methyl]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCCCCCCc1ccccc1NCc1nc(C(=O)Nc2nc(CC(=O)O)cs2)cs1 |
| InChI | InChI=1S/C24H30N4O3S2/c1-2-3-4-5-6-7-10-17-11-8-9-12-19(17)25-14-21-27-20(16-32-21)23(31)28-24-26-18(15-33-24)13-22(29)30/h8-9,11-12,15-16,25H,2-7,10,13-14H2,1H3,(H,29,30)(H,26,28,31) |
| InChIKey | ZVPDILXMFQQDTB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|