C25H31N3O4S — CID 145485645
ethyl 2-[2-[[5-[(2-hexylanilino)methyl]furan-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 145485645) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is ethyl 2-[2-[[5-[(2-hexylanilino)methyl]furan-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[5-[(2-hexylanilino)methyl]furan-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 145485645 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl 2-[2-[[5-[(2-hexylanilino)methyl]furan-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCCCCc1ccccc1NCc1ccc(C(=O)Nc2nc(CC(=O)OCC)cs2)o1 |
| InChI | InChI=1S/C25H31N3O4S/c1-3-5-6-7-10-18-11-8-9-12-21(18)26-16-20-13-14-22(32-20)24(30)28-25-27-19(17-33-25)15-23(29)31-4-2/h8-9,11-14,17,26H,3-7,10,15-16H2,1-2H3,(H,27,28,30) |
| InChIKey | INKIYWYNOIFVSF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|