C28H39N3O2S — CID 145488985
N-(4-ethyl-1,3-thiazol-2-yl)-4-[(2-hexyl-3-methylanilino)methyl]benzamide;methoxymethane (PubChem CID 145488985) has the molecular formula C28H39N3O2S and a molecular weight of 481.71 g/mol. Its IUPAC name is N-(4-ethyl-1,3-thiazol-2-yl)-4-[(2-hexyl-3-methylanilino)methyl]benzamide;methoxymethane.
| Compound Name | N-(4-ethyl-1,3-thiazol-2-yl)-4-[(2-hexyl-3-methylanilino)methyl]benzamide;methoxymethane |
|---|---|
| PubChem CID | 145488985 |
| Molecular Formula | C28H39N3O2S |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | N-(4-ethyl-1,3-thiazol-2-yl)-4-[(2-hexyl-3-methylanilino)methyl]benzamide;methoxymethane |
| SMILES | CCCCCCc1c(C)cccc1NCc1ccc(C(=O)Nc2nc(CC)cs2)cc1.COC |
| InChI | InChI=1S/C26H33N3OS.C2H6O/c1-4-6-7-8-11-23-19(3)10-9-12-24(23)27-17-20-13-15-21(16-14-20)25(30)29-26-28-22(5-2)18-31-26;1-3-2/h9-10,12-16,18,27H,4-8,11,17H2,1-3H3,(H,28,29,30);1-2H3 |
| InChIKey | INOKSHWOARTMMR-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|