C28H33N5OS — CID 145489318
N-[4-(2-cyanoprop-2-enyl)-1,3-thiazol-2-yl]-4-[[(3-octyl-2-pyridinyl)amino]methyl]benzamide (PubChem CID 145489318) has the molecular formula C28H33N5OS and a molecular weight of 487.67 g/mol. Its IUPAC name is N-[4-(2-cyanoprop-2-enyl)-1,3-thiazol-2-yl]-4-[[(3-octyl-2-pyridinyl)amino]methyl]benzamide.
| Compound Name | N-[4-(2-cyanoprop-2-enyl)-1,3-thiazol-2-yl]-4-[[(3-octyl-2-pyridinyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 145489318 |
| Molecular Formula | C28H33N5OS |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[4-(2-cyanoprop-2-enyl)-1,3-thiazol-2-yl]-4-[[(3-octyl-2-pyridinyl)amino]methyl]benzamide |
| SMILES | C=C(C#N)Cc1csc(NC(=O)c2ccc(CNc3ncccc3CCCCCCCC)cc2)n1 |
| InChI | InChI=1S/C28H33N5OS/c1-3-4-5-6-7-8-10-23-11-9-16-30-26(23)31-19-22-12-14-24(15-13-22)27(34)33-28-32-25(20-35-28)17-21(2)18-29/h9,11-16,20H,2-8,10,17,19H2,1H3,(H,30,31)(H,32,33,34) |
| InChIKey | PXAIXKKLFIXEEM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|