C27H34N6O4S — CID 145488700
tert-butyl N-[2-[[5-[[pentyl(1,3-thiazol-2-ylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 145488700) has the molecular formula C27H34N6O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[pentyl(1,3-thiazol-2-ylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[pentyl(1,3-thiazol-2-ylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 145488700 |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | tert-butyl N-[2-[[5-[[pentyl(1,3-thiazol-2-ylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | CCCCCN(Cc1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)nc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C27H34N6O4S/c1-5-6-9-15-33(25(35)32-24-28-14-16-38-24)18-19-12-13-22(29-17-19)23(34)30-20-10-7-8-11-21(20)31-26(36)37-27(2,3)4/h7-8,10-14,16-17H,5-6,9,15,18H2,1-4H3,(H,30,34)(H,31,36)(H,28,32,35) |
| InChIKey | XUMZDOVBCYQUAI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|