C26H32N8O6S — CID 59225124
tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 59225124) has the molecular formula C26H32N8O6S and a molecular weight of 584.66 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 59225124 |
| Molecular Formula | C26H32N8O6S |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | CN(C)CCN(Cc1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)nc1)C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C26H32N8O6S/c1-26(2,3)40-25(37)30-19-9-7-6-8-18(19)29-22(35)20-11-10-17(14-27-20)16-33(13-12-32(4)5)24(36)31-23-28-15-21(41-23)34(38)39/h6-11,14-15H,12-13,16H2,1-5H3,(H,29,35)(H,30,37)(H,28,31,36) |
| InChIKey | KFEIIFPQZOFJDJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|