C26H35N7O4 — CID 59225011
tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-(2-isocyanoethylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 59225011) has the molecular formula C26H35N7O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-(2-isocyanoethylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-(2-isocyanoethylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 59225011 |
| Molecular Formula | C26H35N7O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | tert-butyl N-[2-[[5-[[2-(dimethylamino)ethyl-(2-isocyanoethylcarbamoyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | [C-]#[N+]CCNC(=O)N(CCN(C)C)Cc1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C26H35N7O4/c1-26(2,3)37-25(36)31-21-10-8-7-9-20(21)30-23(34)22-12-11-19(17-29-22)18-33(16-15-32(5)6)24(35)28-14-13-27-4/h7-12,17H,13-16,18H2,1-3,5-6H3,(H,28,35)(H,30,34)(H,31,36) |
| InChIKey | YVGAUNAHUIVKRH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|