About 2-benzyl-5-methyl-2,3-dihydroindol-1-amine
2-benzyl-5-methyl-2,3-dihydroindol-1-amine (PubChem CID 145489465) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-benzyl-5-methyl-2,3-dihydroindol-1-amine.
Molecular Properties
| Compound Name | 2-benzyl-5-methyl-2,3-dihydroindol-1-amine |
| PubChem CID | 145489465 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-benzyl-5-methyl-2,3-dihydroindol-1-amine |
| SMILES | Cc1ccc2c(c1)CC(Cc1ccccc1)N2N |
| InChI | InChI=1S/C16H18N2/c1-12-7-8-16-14(9-12)11-15(18(16)17)10-13-5-3-2-4-6-13/h2-9,15H,10-11,17H2,1H3 |
| InChIKey | HGCVOPYKLMBRGE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-5-methyl-2,3-dihydroindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-methyl-2,3-dihydroindol-1-amine?
The IUPAC name of 2-benzyl-5-methyl-2,3-dihydroindol-1-amine (CID 145489465) is 2-benzyl-5-methyl-2,3-dihydroindol-1-amine.
What is the SMILES notation for 2-benzyl-5-methyl-2,3-dihydroindol-1-amine?
The canonical SMILES for 2-benzyl-5-methyl-2,3-dihydroindol-1-amine is Cc1ccc2c(c1)CC(Cc1ccccc1)N2N.
What is the InChIKey of 2-benzyl-5-methyl-2,3-dihydroindol-1-amine?
The InChIKey is HGCVOPYKLMBRGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c1-12-7-8-16-14(9-12)11-15(18(16)17)10-13-5-3-2-4-6-13/h2-9,15H,10-11,17H2,1H3.
What are the key properties of 2-benzyl-5-methyl-2,3-dihydroindol-1-amine?
2-benzyl-5-methyl-2,3-dihydroindol-1-amine has a molecular weight of 238.33 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-methyl-2,3-dihydroindol-1-amine is sourced from PubChem (CID 145489465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).