C25H28N6O3 — CID 145490189
N-[3-amino-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]oxolane-3-carboxamide (PubChem CID 145490189) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-[3-amino-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]oxolane-3-carboxamide.
| Compound Name | N-[3-amino-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 145490189 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-[3-amino-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]oxolane-3-carboxamide |
| SMILES | Nc1cc(NC(=O)C2CCOC2)ccc1-c1ccnc(Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C25H28N6O3/c26-22-15-19(28-24(32)17-8-12-34-16-17)3-6-21(22)23-7-9-27-25(30-23)29-18-1-4-20(5-2-18)31-10-13-33-14-11-31/h1-7,9,15,17H,8,10-14,16,26H2,(H,28,32)(H,27,29,30) |
| InChIKey | XFCBZGWNPGUTBY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|