About 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane
2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane (PubChem CID 145491899) has the molecular formula C12H20ClNO2
and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane.
Molecular Properties
| Compound Name | 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane |
| PubChem CID | 145491899 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane |
| SMILES | CC.COC.Cc1cc(Cl)c(N)c(C=O)c1 |
| InChI | InChI=1S/C8H8ClNO.C2H6O.C2H6/c1-5-2-6(4-11)8(10)7(9)3-5;1-3-2;1-2/h2-4H,10H2,1H3;1-2H3;1-2H3 |
| InChIKey | WDWYOEZTIMGIDQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane?
The IUPAC name of 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane (CID 145491899) is 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane.
What is the SMILES notation for 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane?
The canonical SMILES for 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane is CC.COC.Cc1cc(Cl)c(N)c(C=O)c1.
What is the InChIKey of 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane?
The InChIKey is WDWYOEZTIMGIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO.C2H6O.C2H6/c1-5-2-6(4-11)8(10)7(9)3-5;1-3-2;1-2/h2-4H,10H2,1H3;1-2H3;1-2H3.
What are the key properties of 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane?
2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane has a molecular weight of 245.75 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-chloro-5-methylbenzaldehyde;ethane;methoxymethane is sourced from PubChem (CID 145491899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).