C8H9N3O2 — CID 2750253
4,5,6-triaminobenzene-1,3-dicarbaldehyde (PubChem CID 2750253) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 4,5,6-triaminobenzene-1,3-dicarbaldehyde.
| Compound Name | 4,5,6-triaminobenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 2750253 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4,5,6-triaminobenzene-1,3-dicarbaldehyde |
| SMILES | Nc1c(C=O)cc(C=O)c(N)c1N |
| InChI | InChI=1S/C8H9N3O2/c9-6-4(2-12)1-5(3-13)7(10)8(6)11/h1-3H,9-11H2 |
| InChIKey | XSLZXBKTAFPZSC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|