C26H26N4O4 — CID 145492215
N-acetyl-2-amino-N-(2-methoxyethyl)-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide (PubChem CID 145492215) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-acetyl-2-amino-N-(2-methoxyethyl)-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide.
| Compound Name | N-acetyl-2-amino-N-(2-methoxyethyl)-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 145492215 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-acetyl-2-amino-N-(2-methoxyethyl)-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
| SMILES | COCCN(C(C)=O)C(=O)c1cc(-c2cnc3[nH]cc(-c4ccccc4OC)c3c2)ccc1N |
| InChI | InChI=1S/C26H26N4O4/c1-16(31)30(10-11-33-2)26(32)21-12-17(8-9-23(21)27)18-13-20-22(15-29-25(20)28-14-18)19-6-4-5-7-24(19)34-3/h4-9,12-15H,10-11,27H2,1-3H3,(H,28,29) |
| InChIKey | XVPNQZYIHAMNDH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|