C22H28Br2N4O — CID 145493009
2-(4-amino-3,5-dibromophenyl)-N-[[6-methyl-2-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]propanamide (PubChem CID 145493009) has the molecular formula C22H28Br2N4O and a molecular weight of 524.30 g/mol. Its IUPAC name is 2-(4-amino-3,5-dibromophenyl)-N-[[6-methyl-2-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]propanamide.
| Compound Name | 2-(4-amino-3,5-dibromophenyl)-N-[[6-methyl-2-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 145493009 |
| Molecular Formula | C22H28Br2N4O |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-(4-amino-3,5-dibromophenyl)-N-[[6-methyl-2-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)C(C)c2cc(Br)c(N)c(Br)c2)c(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C22H28Br2N4O/c1-13-6-8-28(9-7-13)21-16(5-4-14(2)27-21)12-26-22(29)15(3)17-10-18(23)20(25)19(24)11-17/h4-5,10-11,13,15H,6-9,12,25H2,1-3H3,(H,26,29) |
| InChIKey | GTIDJKNSYYNWQA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|