C19H12F2N2O — CID 145494356
4-(3,5-difluorophenyl)-1-[4-(1-hydroxyethenyl)phenyl]pyrrole-3-carbonitrile (PubChem CID 145494356) has the molecular formula C19H12F2N2O and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-1-[4-(1-hydroxyethenyl)phenyl]pyrrole-3-carbonitrile.
| Compound Name | 4-(3,5-difluorophenyl)-1-[4-(1-hydroxyethenyl)phenyl]pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 145494356 |
| Molecular Formula | C19H12F2N2O |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-(3,5-difluorophenyl)-1-[4-(1-hydroxyethenyl)phenyl]pyrrole-3-carbonitrile |
| SMILES | C=C(O)c1ccc(-n2cc(C#N)c(-c3cc(F)cc(F)c3)c2)cc1 |
| InChI | InChI=1S/C19H12F2N2O/c1-12(24)13-2-4-18(5-3-13)23-10-15(9-22)19(11-23)14-6-16(20)8-17(21)7-14/h2-8,10-11,24H,1H2 |
| InChIKey | USKSOAXCLHHHKN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|