C13H8N2O4 — CID 59477916
1-(4-carboxyphenyl)-4-cyanopyrrole-3-carboxylic acid (PubChem CID 59477916) has the molecular formula C13H8N2O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is 1-(4-carboxyphenyl)-4-cyanopyrrole-3-carboxylic acid.
| Compound Name | 1-(4-carboxyphenyl)-4-cyanopyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 59477916 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(4-carboxyphenyl)-4-cyanopyrrole-3-carboxylic acid |
| SMILES | N#Cc1cn(-c2ccc(C(=O)O)cc2)cc1C(=O)O |
| InChI | InChI=1S/C13H8N2O4/c14-5-9-6-15(7-11(9)13(18)19)10-3-1-8(2-4-10)12(16)17/h1-4,6-7H,(H,16,17)(H,18,19) |
| InChIKey | KQLDIEFEUOUYFI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |