C26H20N2O4 — CID 59477754
4-[3-cyano-4-[2-[(2-methoxyphenyl)methoxy]phenyl]pyrrol-1-yl]benzoic acid (PubChem CID 59477754) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-[3-cyano-4-[2-[(2-methoxyphenyl)methoxy]phenyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-[3-cyano-4-[2-[(2-methoxyphenyl)methoxy]phenyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59477754 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-[3-cyano-4-[2-[(2-methoxyphenyl)methoxy]phenyl]pyrrol-1-yl]benzoic acid |
| SMILES | COc1ccccc1COc1ccccc1-c1cn(-c2ccc(C(=O)O)cc2)cc1C#N |
| InChI | InChI=1S/C26H20N2O4/c1-31-24-8-4-2-6-19(24)17-32-25-9-5-3-7-22(25)23-16-28(15-20(23)14-27)21-12-10-18(11-13-21)26(29)30/h2-13,15-16H,17H2,1H3,(H,29,30) |
| InChIKey | JQSSMIBJGOLTET-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |