C28H23NO3 — CID 145494168
4-[3-[3-[(2-methylphenyl)methoxy]phenyl]-4-prop-1-ynylpyrrol-1-yl]benzoic acid (PubChem CID 145494168) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[3-[3-[(2-methylphenyl)methoxy]phenyl]-4-prop-1-ynylpyrrol-1-yl]benzoic acid.
| Compound Name | 4-[3-[3-[(2-methylphenyl)methoxy]phenyl]-4-prop-1-ynylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 145494168 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-[3-[3-[(2-methylphenyl)methoxy]phenyl]-4-prop-1-ynylpyrrol-1-yl]benzoic acid |
| SMILES | CC#Cc1cn(-c2ccc(C(=O)O)cc2)cc1-c1cccc(OCc2ccccc2C)c1 |
| InChI | InChI=1S/C28H23NO3/c1-3-7-23-17-29(25-14-12-21(13-15-25)28(30)31)18-27(23)22-10-6-11-26(16-22)32-19-24-9-5-4-8-20(24)2/h4-6,8-18H,19H2,1-2H3,(H,30,31) |
| InChIKey | CWVCDEHCCXNZQU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|