C25H29N3O5 — CID 145495499
1',5-dimethylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione;methyl N-benzyl-N-(2-oxopropyl)carbamate (PubChem CID 145495499) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 1',5-dimethylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione;methyl N-benzyl-N-(2-oxopropyl)carbamate.
| Compound Name | 1',5-dimethylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione;methyl N-benzyl-N-(2-oxopropyl)carbamate |
|---|---|
| PubChem CID | 145495499 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1',5-dimethylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione;methyl N-benzyl-N-(2-oxopropyl)carbamate |
| SMILES | COC(=O)N(CC(C)=O)Cc1ccccc1.Cc1ccc2c(c1)CC1(C2)C(=O)NC(=O)N1C |
| InChI | InChI=1S/C13H14N2O2.C12H15NO3/c1-8-3-4-9-6-13(7-10(9)5-8)11(16)14-12(17)15(13)2;1-10(14)8-13(12(15)16-2)9-11-6-4-3-5-7-11/h3-5H,6-7H2,1-2H3,(H,14,16,17);3-7H,8-9H2,1-2H3 |
| InChIKey | ZSUPDOBSYCANOR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|