C21H30N2O6 — CID 143150981
methyl 2-[benzyl-[2-[2-methylbutan-2-yloxycarbonyl(2-oxopropyl)amino]acetyl]amino]acetate (PubChem CID 143150981) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 2-[benzyl-[2-[2-methylbutan-2-yloxycarbonyl(2-oxopropyl)amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[benzyl-[2-[2-methylbutan-2-yloxycarbonyl(2-oxopropyl)amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 143150981 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | methyl 2-[benzyl-[2-[2-methylbutan-2-yloxycarbonyl(2-oxopropyl)amino]acetyl]amino]acetate |
| SMILES | CCC(C)(C)OC(=O)N(CC(C)=O)CC(=O)N(CC(=O)OC)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N2O6/c1-6-21(3,4)29-20(27)23(12-16(2)24)14-18(25)22(15-19(26)28-5)13-17-10-8-7-9-11-17/h7-11H,6,12-15H2,1-5H3 |
| InChIKey | SUPPURPHLORWAY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |