C22H28N4O2S — CID 145497688
2-[[3-[[4-[(3Z)-2-methoxyhexa-1,3,5-trien-3-yl]-5-methylpyrimidin-2-yl]amino]phenyl]methylsulfanyl-methylamino]ethanol (PubChem CID 145497688) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[[3-[[4-[(3Z)-2-methoxyhexa-1,3,5-trien-3-yl]-5-methylpyrimidin-2-yl]amino]phenyl]methylsulfanyl-methylamino]ethanol.
| Compound Name | 2-[[3-[[4-[(3Z)-2-methoxyhexa-1,3,5-trien-3-yl]-5-methylpyrimidin-2-yl]amino]phenyl]methylsulfanyl-methylamino]ethanol |
|---|---|
| PubChem CID | 145497688 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[[3-[[4-[(3Z)-2-methoxyhexa-1,3,5-trien-3-yl]-5-methylpyrimidin-2-yl]amino]phenyl]methylsulfanyl-methylamino]ethanol |
| SMILES | C=C/C=C(\C(=C)OC)c1nc(Nc2cccc(CSN(C)CCO)c2)ncc1C |
| InChI | InChI=1S/C22H28N4O2S/c1-6-8-20(17(3)28-5)21-16(2)14-23-22(25-21)24-19-10-7-9-18(13-19)15-29-26(4)11-12-27/h6-10,13-14,27H,1,3,11-12,15H2,2,4-5H3,(H,23,24,25)/b20-8+ |
| InChIKey | RVZOFTRWBRFJRF-DNTJNYDQSA-N |
| XLogP | 4.33 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|