C12H13ClFN — CID 145498420
chloromethane;2-fluoro-6,7-dimethylquinoline (PubChem CID 145498420) has the molecular formula C12H13ClFN and a molecular weight of 225.69 g/mol. Its IUPAC name is chloromethane;2-fluoro-6,7-dimethylquinoline.
| Compound Name | chloromethane;2-fluoro-6,7-dimethylquinoline |
|---|---|
| PubChem CID | 145498420 |
| Molecular Formula | C12H13ClFN |
| Molecular Weight | 225.69 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | chloromethane;2-fluoro-6,7-dimethylquinoline |
| SMILES | CCl.Cc1cc2ccc(F)nc2cc1C |
| InChI | InChI=1S/C11H10FN.CH3Cl/c1-7-5-9-3-4-11(12)13-10(9)6-8(7)2;1-2/h3-6H,1-2H3;1H3 |
| InChIKey | OAGIYUXCTJBOCR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|