C11H10FN — CID 143814242
7-fluoro-2,6-dimethylquinoline (PubChem CID 143814242) has the molecular formula C11H10FN and a molecular weight of 175.21 g/mol. Its IUPAC name is 7-fluoro-2,6-dimethylquinoline.
| Compound Name | 7-fluoro-2,6-dimethylquinoline |
|---|---|
| PubChem CID | 143814242 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 7-fluoro-2,6-dimethylquinoline |
| SMILES | Cc1ccc2cc(C)c(F)cc2n1 |
| InChI | InChI=1S/C11H10FN/c1-7-5-9-4-3-8(2)13-11(9)6-10(7)12/h3-6H,1-2H3 |
| InChIKey | JMWIFNLHSPMAOJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |